About S-pyridin-3-yl propanethioate
S-pyridin-3-yl propanethioate (PubChem CID 56621142) has the molecular formula C8H9NOS
and a molecular weight of 167.23 g/mol. Its IUPAC name is S-pyridin-3-yl propanethioate.
Molecular Properties
| Compound Name | S-pyridin-3-yl propanethioate |
| PubChem CID | 56621142 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | S-pyridin-3-yl propanethioate |
| SMILES | CCC(=O)Sc1cccnc1 |
| InChI | InChI=1S/C8H9NOS/c1-2-8(10)11-7-4-3-5-9-6-7/h3-6H,2H2,1H3 |
| InChIKey | NLRJLLMSCYIMKA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-pyridin-3-yl propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-pyridin-3-yl propanethioate?
The IUPAC name of S-pyridin-3-yl propanethioate (CID 56621142) is S-pyridin-3-yl propanethioate.
What is the SMILES notation for S-pyridin-3-yl propanethioate?
The canonical SMILES for S-pyridin-3-yl propanethioate is CCC(=O)Sc1cccnc1.
What is the InChIKey of S-pyridin-3-yl propanethioate?
The InChIKey is NLRJLLMSCYIMKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS/c1-2-8(10)11-7-4-3-5-9-6-7/h3-6H,2H2,1H3.
What are the key properties of S-pyridin-3-yl propanethioate?
S-pyridin-3-yl propanethioate has a molecular weight of 167.23 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-pyridin-3-yl propanethioate is sourced from PubChem (CID 56621142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).