C8H10N2S3 — CID 169235462
1,1-bis(methylsulfanyl)-N-pyridin-3-ylsulfanylmethanimine (PubChem CID 169235462) has the molecular formula C8H10N2S3 and a molecular weight of 230.38 g/mol. Its IUPAC name is 1,1-bis(methylsulfanyl)-N-pyridin-3-ylsulfanylmethanimine.
| Compound Name | 1,1-bis(methylsulfanyl)-N-pyridin-3-ylsulfanylmethanimine |
|---|---|
| PubChem CID | 169235462 |
| Molecular Formula | C8H10N2S3 |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 1,1-bis(methylsulfanyl)-N-pyridin-3-ylsulfanylmethanimine |
| SMILES | CSC(=NSc1cccnc1)SC |
| InChI | InChI=1S/C8H10N2S3/c1-11-8(12-2)10-13-7-4-3-5-9-6-7/h3-6H,1-2H3 |
| InChIKey | HNVUJHARQVLYIG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|