acetic acid;3-propan-2-ylsulfinylpyridine

C10H15NO3S — CID 174749831

IUPACacetic acid;3-propan-2-ylsulfinylpyridine
SMILESCC(=O)O.CC(C)S(=O)c1cccnc1
InChIInChI=1S/C8H11NOS.C2H4O2/c1-7(2)11(10)8-4-3-5-9-6-8;1-2(3)4/h3-7H,1-2H3;1H3,(H,3,4)
InChIKeyXPBLRGPXNFLSLI-UHFFFAOYSA-N
MW229.30 g/mol
LogP1.69
Rot. Bonds2

About acetic acid;3-propan-2-ylsulfinylpyridine

acetic acid;3-propan-2-ylsulfinylpyridine (PubChem CID 174749831) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is acetic acid;3-propan-2-ylsulfinylpyridine.

Molecular Properties

Compound Nameacetic acid;3-propan-2-ylsulfinylpyridine
PubChem CID174749831
Molecular FormulaC10H15NO3S
Molecular Weight229.30 g/mol
Exact Mass229.08
IUPAC Nameacetic acid;3-propan-2-ylsulfinylpyridine
SMILESCC(=O)O.CC(C)S(=O)c1cccnc1
InChIInChI=1S/C8H11NOS.C2H4O2/c1-7(2)11(10)8-4-3-5-9-6-8;1-2(3)4/h3-7H,1-2H3;1H3,(H,3,4)
InChIKeyXPBLRGPXNFLSLI-UHFFFAOYSA-N
XLogP1.69
TPSA67.26 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.30
LogP ≤ 51.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze acetic acid;3-propan-2-ylsulfinylpyridine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;3-propan-2-ylsulfinylpyridine?
The IUPAC name of acetic acid;3-propan-2-ylsulfinylpyridine (CID 174749831) is acetic acid;3-propan-2-ylsulfinylpyridine.
What is the SMILES notation for acetic acid;3-propan-2-ylsulfinylpyridine?
The canonical SMILES for acetic acid;3-propan-2-ylsulfinylpyridine is CC(=O)O.CC(C)S(=O)c1cccnc1.
What is the InChIKey of acetic acid;3-propan-2-ylsulfinylpyridine?
The InChIKey is XPBLRGPXNFLSLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS.C2H4O2/c1-7(2)11(10)8-4-3-5-9-6-8;1-2(3)4/h3-7H,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;3-propan-2-ylsulfinylpyridine?
acetic acid;3-propan-2-ylsulfinylpyridine has a molecular weight of 229.30 g/mol, XLogP of 1.69, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3-propan-2-ylsulfinylpyridine is sourced from PubChem (CID 174749831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).