About methyl pyridine-3-sulfinate
methyl pyridine-3-sulfinate (PubChem CID 18713773) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is methyl pyridine-3-sulfinate.
Molecular Properties
| Compound Name | methyl pyridine-3-sulfinate |
| PubChem CID | 18713773 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | methyl pyridine-3-sulfinate |
| SMILES | COS(=O)c1cccnc1 |
| InChI | InChI=1S/C6H7NO2S/c1-9-10(8)6-3-2-4-7-5-6/h2-5H,1H3 |
| InChIKey | XXYMCTAEDDWSDS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl pyridine-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl pyridine-3-sulfinate?
The IUPAC name of methyl pyridine-3-sulfinate (CID 18713773) is methyl pyridine-3-sulfinate.
What is the SMILES notation for methyl pyridine-3-sulfinate?
The canonical SMILES for methyl pyridine-3-sulfinate is COS(=O)c1cccnc1.
What is the InChIKey of methyl pyridine-3-sulfinate?
The InChIKey is XXYMCTAEDDWSDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c1-9-10(8)6-3-2-4-7-5-6/h2-5H,1H3.
What are the key properties of methyl pyridine-3-sulfinate?
methyl pyridine-3-sulfinate has a molecular weight of 157.19 g/mol, XLogP of 0.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl pyridine-3-sulfinate is sourced from PubChem (CID 18713773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).