About pyridin-3-ylmethyl sulfite
pyridin-3-ylmethyl sulfite (PubChem CID 56985021) has the molecular formula C6H6NO3S-
and a molecular weight of 172.19 g/mol. Its IUPAC name is pyridin-3-ylmethyl sulfite.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl sulfite |
| PubChem CID | 56985021 |
| Molecular Formula | C6H6NO3S- |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | pyridin-3-ylmethyl sulfite |
| SMILES | O=S([O-])OCc1cccnc1 |
| InChI | InChI=1S/C6H7NO3S/c8-11(9)10-5-6-2-1-3-7-4-6/h1-4H,5H2,(H,8,9)/p-1 |
| InChIKey | OANWGLIHFPNGKD-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl sulfite?
The IUPAC name of pyridin-3-ylmethyl sulfite (CID 56985021) is pyridin-3-ylmethyl sulfite.
What is the SMILES notation for pyridin-3-ylmethyl sulfite?
The canonical SMILES for pyridin-3-ylmethyl sulfite is O=S([O-])OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl sulfite?
The InChIKey is OANWGLIHFPNGKD-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H7NO3S/c8-11(9)10-5-6-2-1-3-7-4-6/h1-4H,5H2,(H,8,9)/p-1.
What are the key properties of pyridin-3-ylmethyl sulfite?
pyridin-3-ylmethyl sulfite has a molecular weight of 172.19 g/mol, XLogP of 0.39, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl sulfite is sourced from PubChem (CID 56985021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).