About pyridin-3-ylmethyl 2-ethylbutanoate
pyridin-3-ylmethyl 2-ethylbutanoate (PubChem CID 78841882) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is pyridin-3-ylmethyl 2-ethylbutanoate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl 2-ethylbutanoate |
| PubChem CID | 78841882 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | pyridin-3-ylmethyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C12H17NO2/c1-3-11(4-2)12(14)15-9-10-6-5-7-13-8-10/h5-8,11H,3-4,9H2,1-2H3 |
| InChIKey | WHSQRRKLRFGJNQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-3-ylmethyl 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl 2-ethylbutanoate?
The IUPAC name of pyridin-3-ylmethyl 2-ethylbutanoate (CID 78841882) is pyridin-3-ylmethyl 2-ethylbutanoate.
What is the SMILES notation for pyridin-3-ylmethyl 2-ethylbutanoate?
The canonical SMILES for pyridin-3-ylmethyl 2-ethylbutanoate is CCC(CC)C(=O)OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl 2-ethylbutanoate?
The InChIKey is WHSQRRKLRFGJNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-3-11(4-2)12(14)15-9-10-6-5-7-13-8-10/h5-8,11H,3-4,9H2,1-2H3.
What are the key properties of pyridin-3-ylmethyl 2-ethylbutanoate?
pyridin-3-ylmethyl 2-ethylbutanoate has a molecular weight of 207.27 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl 2-ethylbutanoate is sourced from PubChem (CID 78841882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).