C10H13N3O3 — CID 69135337
pyridin-3-ylmethyl (2S)-2,3-diamino-2-methyl-3-oxopropanoate (PubChem CID 69135337) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is pyridin-3-ylmethyl (2S)-2,3-diamino-2-methyl-3-oxopropanoate.
| Compound Name | pyridin-3-ylmethyl (2S)-2,3-diamino-2-methyl-3-oxopropanoate |
|---|---|
| PubChem CID | 69135337 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | pyridin-3-ylmethyl (2S)-2,3-diamino-2-methyl-3-oxopropanoate |
| SMILES | C[C@](N)(C(N)=O)C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C10H13N3O3/c1-10(12,8(11)14)9(15)16-6-7-3-2-4-13-5-7/h2-5H,6,12H2,1H3,(H2,11,14)/t10-/m0/s1 |
| InChIKey | XCXQVXTUUIOXBP-JTQLQIEISA-N |
| XLogP | -0.67 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|