C24H31NO2 — CID 91726940
pyridin-3-ylmethyl (2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoate (PubChem CID 91726940) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is pyridin-3-ylmethyl (2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoate.
| Compound Name | pyridin-3-ylmethyl (2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoate |
|---|---|
| PubChem CID | 91726940 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | pyridin-3-ylmethyl (2E,6Z,9Z,12Z,15Z)-octadeca-2,6,9,12,15-pentaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CC/C=C/C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C24H31NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-24(26)27-22-23-18-17-20-25-21-23/h3-4,6-7,9-10,12-13,16-21H,2,5,8,11,14-15,22H2,1H3/b4-3-,7-6-,10-9-,13-12-,19-16+ |
| InChIKey | ZBSALCWKBMZZPX-HQSSOVABSA-N |
| XLogP | 6.27 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|