C19H27NO6 — CID 155326813
pyridin-3-ylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate (PubChem CID 155326813) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is pyridin-3-ylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate.
| Compound Name | pyridin-3-ylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 155326813 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | pyridin-3-ylmethyl (E,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
| SMILES | C[C@H](CC/C=C/C(=O)OCc1cccnc1)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H27NO6/c1-13(25-19-17(22)10-16(21)14(2)26-19)6-3-4-8-18(23)24-12-15-7-5-9-20-11-15/h4-5,7-9,11,13-14,16-17,19,21-22H,3,6,10,12H2,1-2H3/b8-4+/t13-,14+,16-,17-,19-/m1/s1 |
| InChIKey | ZRNKMMYWHRLVOK-ZFOVETDOSA-N |
| XLogP | 1.72 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|