C27H40O6 — CID 118894209
[(2R,5R)-2-[(E,2S)-11-ethoxy-11-oxoundec-9-en-2-yl]oxy-5,6-dimethyloxan-3-yl] benzoate (PubChem CID 118894209) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is [(2R,5R)-2-[(E,2S)-11-ethoxy-11-oxoundec-9-en-2-yl]oxy-5,6-dimethyloxan-3-yl] benzoate.
| Compound Name | [(2R,5R)-2-[(E,2S)-11-ethoxy-11-oxoundec-9-en-2-yl]oxy-5,6-dimethyloxan-3-yl] benzoate |
|---|---|
| PubChem CID | 118894209 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | [(2R,5R)-2-[(E,2S)-11-ethoxy-11-oxoundec-9-en-2-yl]oxy-5,6-dimethyloxan-3-yl] benzoate |
| SMILES | CCOC(=O)/C=C/CCCCCC[C@H](C)O[C@@H]1OC(C)[C@H](C)CC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C27H40O6/c1-5-30-25(28)18-14-9-7-6-8-11-15-21(3)31-27-24(19-20(2)22(4)32-27)33-26(29)23-16-12-10-13-17-23/h10,12-14,16-18,20-22,24,27H,5-9,11,15,19H2,1-4H3/b18-14+/t20-,21+,22?,24?,27-/m1/s1 |
| InChIKey | LRHBEAXTTGBESQ-JBTDOGTASA-N |
| XLogP | 5.85 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|