C15H27NO4 — CID 155725437
(E,6R)-6-[(3R,6S)-3-hydroxy-5,6-dimethyloxan-2-yl]oxy-N-methylhept-2-enamide (PubChem CID 155725437) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is (E,6R)-6-[(3R,6S)-3-hydroxy-5,6-dimethyloxan-2-yl]oxy-N-methylhept-2-enamide.
| Compound Name | (E,6R)-6-[(3R,6S)-3-hydroxy-5,6-dimethyloxan-2-yl]oxy-N-methylhept-2-enamide |
|---|---|
| PubChem CID | 155725437 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (E,6R)-6-[(3R,6S)-3-hydroxy-5,6-dimethyloxan-2-yl]oxy-N-methylhept-2-enamide |
| SMILES | CNC(=O)/C=C/CC[C@@H](C)OC1O[C@@H](C)C(C)C[C@H]1O |
| InChI | InChI=1S/C15H27NO4/c1-10-9-13(17)15(20-12(10)3)19-11(2)7-5-6-8-14(18)16-4/h6,8,10-13,15,17H,5,7,9H2,1-4H3,(H,16,18)/b8-6+/t10?,11-,12+,13-,15?/m1/s1 |
| InChIKey | HVZLCYYLHAAXLG-AIQPUHQNSA-N |
| XLogP | 1.61 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|