C14H25NO5 — CID 155735475
(E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-N-methylhept-2-enamide (PubChem CID 155735475) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is (E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-N-methylhept-2-enamide.
| Compound Name | (E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-N-methylhept-2-enamide |
|---|---|
| PubChem CID | 155735475 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | (E,6R)-6-[(3R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-N-methylhept-2-enamide |
| SMILES | CNC(=O)/C=C/CC[C@@H](C)OC1O[C@@H](C)C(O)C[C@H]1O |
| InChI | InChI=1S/C14H25NO5/c1-9(6-4-5-7-13(18)15-3)19-14-12(17)8-11(16)10(2)20-14/h5,7,9-12,14,16-17H,4,6,8H2,1-3H3,(H,15,18)/b7-5+/t9-,10+,11?,12-,14?/m1/s1 |
| InChIKey | VWYAYMLYIBKRPO-MRQKIRMPSA-N |
| XLogP | 0.33 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|