C15H26O5 — CID 167492292
(E)-8-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxynon-4-en-3-one (PubChem CID 167492292) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is (E)-8-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxynon-4-en-3-one.
| Compound Name | (E)-8-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxynon-4-en-3-one |
|---|---|
| PubChem CID | 167492292 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (E)-8-[(2R,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxynon-4-en-3-one |
| SMILES | CCC(=O)/C=C/CCC(C)O[C@@H]1OC(C)[C@H](O)CC1O |
| InChI | InChI=1S/C15H26O5/c1-4-12(16)8-6-5-7-10(2)19-15-14(18)9-13(17)11(3)20-15/h6,8,10-11,13-15,17-18H,4-5,7,9H2,1-3H3/b8-6+/t10?,11?,13-,14?,15-/m1/s1 |
| InChIKey | JALYGJCFEJVEKG-PCTFLSGASA-N |
| XLogP | 1.56 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|