C17H30O6 — CID 174031490
tert-butyl (E,6R)-6-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate (PubChem CID 174031490) has the molecular formula C17H30O6 and a molecular weight of 330.42 g/mol. Its IUPAC name is tert-butyl (E,6R)-6-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate.
| Compound Name | tert-butyl (E,6R)-6-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
|---|---|
| PubChem CID | 174031490 |
| Molecular Formula | C17H30O6 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | tert-butyl (E,6R)-6-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyhept-2-enoate |
| SMILES | CC1OC(O[C@H](C)CC/C=C/C(=O)OC(C)(C)C)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H30O6/c1-11(8-6-7-9-15(20)23-17(3,4)5)21-16-14(19)10-13(18)12(2)22-16/h7,9,11-14,16,18-19H,6,8,10H2,1-5H3/b9-7+/t11-,12?,13-,14+,16?/m1/s1 |
| InChIKey | OJXGZLVMZDXCJN-YZIWFKHQSA-N |
| XLogP | 1.93 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|