C18H34O6 — CID 155725482
tert-butyl (3R,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3-methylheptanoate (PubChem CID 155725482) has the molecular formula C18H34O6 and a molecular weight of 346.46 g/mol. Its IUPAC name is tert-butyl (3R,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3-methylheptanoate.
| Compound Name | tert-butyl (3R,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3-methylheptanoate |
|---|---|
| PubChem CID | 155725482 |
| Molecular Formula | C18H34O6 |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | tert-butyl (3R,6R)-6-[(2R,3R,5R,6S)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3-methylheptanoate |
| SMILES | C[C@H](CC[C@@H](C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34O6/c1-11(9-16(21)24-18(4,5)6)7-8-12(2)22-17-15(20)10-14(19)13(3)23-17/h11-15,17,19-20H,7-10H2,1-6H3/t11-,12-,13+,14-,15-,17-/m1/s1 |
| InChIKey | OWVYEJOBHTXUBY-LQCKPJBFSA-N |
| XLogP | 2.40 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |