C16H28O6 — CID 167276695
tert-butyl (6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]heptanoate (PubChem CID 167276695) has the molecular formula C16H28O6 and a molecular weight of 316.39 g/mol. Its IUPAC name is tert-butyl (6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]heptanoate.
| Compound Name | tert-butyl (6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]heptanoate |
|---|---|
| PubChem CID | 167276695 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | tert-butyl (6R)-6-[[(6R)-4-hydroxy-2,7-dioxabicyclo[4.1.0]heptan-3-yl]oxy]heptanoate |
| SMILES | C[C@H](CCCCC(=O)OC(C)(C)C)OC1OC2O[C@@H]2CC1O |
| InChI | InChI=1S/C16H28O6/c1-10(7-5-6-8-13(18)22-16(2,3)4)19-14-11(17)9-12-15(20-12)21-14/h10-12,14-15,17H,5-9H2,1-4H3/t10-,11?,12-,14?,15?/m1/s1 |
| InChIKey | CRAHJJHSRIKBSL-MASVLEMTSA-N |
| XLogP | 2.13 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|