C14H26O5 — CID 144528479
(7R)-7-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyoctan-2-one (PubChem CID 144528479) has the molecular formula C14H26O5 and a molecular weight of 274.36 g/mol. Its IUPAC name is (7R)-7-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyoctan-2-one.
| Compound Name | (7R)-7-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyoctan-2-one |
|---|---|
| PubChem CID | 144528479 |
| Molecular Formula | C14H26O5 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | (7R)-7-[(3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxyoctan-2-one |
| SMILES | CC(=O)CCCC[C@@H](C)OC1OC(C)[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C14H26O5/c1-9(15)6-4-5-7-10(2)18-14-13(17)8-12(16)11(3)19-14/h10-14,16-17H,4-8H2,1-3H3/t10-,11?,12-,13+,14?/m1/s1 |
| InChIKey | VMUQMCYANUIXIR-HUEPFSFMSA-N |
| XLogP | 1.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|