C17H32O8 — CID 71261896
(10R)-10-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3,8-dihydroxyundecanoic acid (PubChem CID 71261896) has the molecular formula C17H32O8 and a molecular weight of 364.44 g/mol. Its IUPAC name is (10R)-10-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3,8-dihydroxyundecanoic acid.
| Compound Name | (10R)-10-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3,8-dihydroxyundecanoic acid |
|---|---|
| PubChem CID | 71261896 |
| Molecular Formula | C17H32O8 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | (10R)-10-[(2R,3S,5R)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-3,8-dihydroxyundecanoic acid |
| SMILES | CC1O[C@@H](O[C@H](C)CC(O)CCCCC(O)CC(=O)O)[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C17H32O8/c1-10(24-17-15(21)9-14(20)11(2)25-17)7-12(18)5-3-4-6-13(19)8-16(22)23/h10-15,17-21H,3-9H2,1-2H3,(H,22,23)/t10-,11?,12?,13?,14-,15+,17-/m1/s1 |
| InChIKey | KOPWGKUEIMDQOP-PRSHZJGHSA-N |
| XLogP | 0.40 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|