C20H39NO5 — CID 144528408
(10R)-10-[(2R,3S,5R)-5-hydroxy-3,6-dimethyloxan-2-yl]oxy-N-(2-hydroxyethyl)undecanamide (PubChem CID 144528408) has the molecular formula C20H39NO5 and a molecular weight of 373.53 g/mol. Its IUPAC name is (10R)-10-[(2R,3S,5R)-5-hydroxy-3,6-dimethyloxan-2-yl]oxy-N-(2-hydroxyethyl)undecanamide.
| Compound Name | (10R)-10-[(2R,3S,5R)-5-hydroxy-3,6-dimethyloxan-2-yl]oxy-N-(2-hydroxyethyl)undecanamide |
|---|---|
| PubChem CID | 144528408 |
| Molecular Formula | C20H39NO5 |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | (10R)-10-[(2R,3S,5R)-5-hydroxy-3,6-dimethyloxan-2-yl]oxy-N-(2-hydroxyethyl)undecanamide |
| SMILES | CC1O[C@@H](O[C@H](C)CCCCCCCCC(=O)NCCO)[C@@H](C)C[C@H]1O |
| InChI | InChI=1S/C20H39NO5/c1-15-14-18(23)17(3)26-20(15)25-16(2)10-8-6-4-5-7-9-11-19(24)21-12-13-22/h15-18,20,22-23H,4-14H2,1-3H3,(H,21,24)/t15-,16+,17?,18+,20+/m0/s1 |
| InChIKey | ROTMURVPFGKWLI-WVYXSJDDSA-N |
| XLogP | 2.75 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|