C19H40O5Si — CID 11682306
(2R,3R,5R,6S)-2-[(2R)-7-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-6-methyloxane-3,5-diol (PubChem CID 11682306) has the molecular formula C19H40O5Si and a molecular weight of 376.61 g/mol. Its IUPAC name is (2R,3R,5R,6S)-2-[(2R)-7-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-6-methyloxane-3,5-diol.
| Compound Name | (2R,3R,5R,6S)-2-[(2R)-7-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-6-methyloxane-3,5-diol |
|---|---|
| PubChem CID | 11682306 |
| Molecular Formula | C19H40O5Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (2R,3R,5R,6S)-2-[(2R)-7-[tert-butyl(dimethyl)silyl]oxyheptan-2-yl]oxy-6-methyloxane-3,5-diol |
| SMILES | C[C@H](CCCCCO[Si](C)(C)C(C)(C)C)O[C@@H]1O[C@@H](C)[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C19H40O5Si/c1-14(23-18-17(21)13-16(20)15(2)24-18)11-9-8-10-12-22-25(6,7)19(3,4)5/h14-18,20-21H,8-13H2,1-7H3/t14-,15+,16-,17-,18-/m1/s1 |
| InChIKey | ANLYOVYZKLNEMI-CWQOZTLDSA-N |
| XLogP | 3.83 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|