About azetidine;ethene;pyridine-3-sulfinate
azetidine;ethene;pyridine-3-sulfinate (PubChem CID 171796867) has the molecular formula C10H15N2O2S-
and a molecular weight of 227.31 g/mol. Its IUPAC name is azetidine;ethene;pyridine-3-sulfinate.
Molecular Properties
| Compound Name | azetidine;ethene;pyridine-3-sulfinate |
| PubChem CID | 171796867 |
| Molecular Formula | C10H15N2O2S- |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | azetidine;ethene;pyridine-3-sulfinate |
| SMILES | C1CNC1.C=C.O=S([O-])c1cccnc1 |
| InChI | InChI=1S/C5H5NO2S.C3H7N.C2H4/c7-9(8)5-2-1-3-6-4-5;1-2-4-3-1;1-2/h1-4H,(H,7,8);4H,1-3H2;1-2H2/p-1 |
| InChIKey | PBNHXDRITANOGK-UHFFFAOYSA-M |
| XLogP | 1.10 |
| TPSA | 65.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze azetidine;ethene;pyridine-3-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine;ethene;pyridine-3-sulfinate?
The IUPAC name of azetidine;ethene;pyridine-3-sulfinate (CID 171796867) is azetidine;ethene;pyridine-3-sulfinate.
What is the SMILES notation for azetidine;ethene;pyridine-3-sulfinate?
The canonical SMILES for azetidine;ethene;pyridine-3-sulfinate is C1CNC1.C=C.O=S([O-])c1cccnc1.
What is the InChIKey of azetidine;ethene;pyridine-3-sulfinate?
The InChIKey is PBNHXDRITANOGK-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H5NO2S.C3H7N.C2H4/c7-9(8)5-2-1-3-6-4-5;1-2-4-3-1;1-2/h1-4H,(H,7,8);4H,1-3H2;1-2H2/p-1.
What are the key properties of azetidine;ethene;pyridine-3-sulfinate?
azetidine;ethene;pyridine-3-sulfinate has a molecular weight of 227.31 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine;ethene;pyridine-3-sulfinate is sourced from PubChem (CID 171796867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).