C11H17N3 — CID 83698004
N-methyl-N-piperidin-3-ylpyridin-3-amine (PubChem CID 83698004) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N-methyl-N-piperidin-3-ylpyridin-3-amine.
| Compound Name | N-methyl-N-piperidin-3-ylpyridin-3-amine |
|---|---|
| PubChem CID | 83698004 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N-methyl-N-piperidin-3-ylpyridin-3-amine |
| SMILES | CN(c1cccnc1)C1CCCNC1 |
| InChI | InChI=1S/C11H17N3/c1-14(10-4-2-6-12-8-10)11-5-3-7-13-9-11/h2,4,6,8,11,13H,3,5,7,9H2,1H3 |
| InChIKey | SRYMUVOKHBNOEX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |