C12H18Cl2F3N3 — CID 146077841
N-methyl-N-piperidin-3-yl-3-(trifluoromethyl)pyridin-2-amine;dihydrochloride (PubChem CID 146077841) has the molecular formula C12H18Cl2F3N3 and a molecular weight of 332.20 g/mol. Its IUPAC name is N-methyl-N-piperidin-3-yl-3-(trifluoromethyl)pyridin-2-amine;dihydrochloride.
| Compound Name | N-methyl-N-piperidin-3-yl-3-(trifluoromethyl)pyridin-2-amine;dihydrochloride |
|---|---|
| PubChem CID | 146077841 |
| Molecular Formula | C12H18Cl2F3N3 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-methyl-N-piperidin-3-yl-3-(trifluoromethyl)pyridin-2-amine;dihydrochloride |
| SMILES | CN(c1ncccc1C(F)(F)F)C1CCCNC1.Cl.Cl |
| InChI | InChI=1S/C12H16F3N3.2ClH/c1-18(9-4-2-6-16-8-9)11-10(12(13,14)15)5-3-7-17-11;;/h3,5,7,9,16H,2,4,6,8H2,1H3;2*1H |
| InChIKey | RHIXJQRZPJXZST-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |