About methyl (R)-benzenesulfinate
methyl (R)-benzenesulfinate (PubChem CID 11735002) has the molecular formula C7H8O2S
and a molecular weight of 156.21 g/mol. Its IUPAC name is methyl (R)-benzenesulfinate.
Molecular Properties
| Compound Name | methyl (R)-benzenesulfinate |
| PubChem CID | 11735002 |
| Molecular Formula | C7H8O2S |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.02 |
| IUPAC Name | methyl (R)-benzenesulfinate |
| SMILES | CO[S@@](=O)c1ccccc1 |
| InChI | InChI=1S/C7H8O2S/c1-9-10(8)7-5-3-2-4-6-7/h2-6H,1H3/t10-/m1/s1 |
| InChIKey | PSNSVDSRLUYDKF-SNVBAGLBSA-N |
| XLogP | 1.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl (R)-benzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (R)-benzenesulfinate?
The IUPAC name of methyl (R)-benzenesulfinate (CID 11735002) is methyl (R)-benzenesulfinate.
What is the SMILES notation for methyl (R)-benzenesulfinate?
The canonical SMILES for methyl (R)-benzenesulfinate is CO[S@@](=O)c1ccccc1.
What is the InChIKey of methyl (R)-benzenesulfinate?
The InChIKey is PSNSVDSRLUYDKF-SNVBAGLBSA-N. The full InChI is InChI=1S/C7H8O2S/c1-9-10(8)7-5-3-2-4-6-7/h2-6H,1H3/t10-/m1/s1.
What are the key properties of methyl (R)-benzenesulfinate?
methyl (R)-benzenesulfinate has a molecular weight of 156.21 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (R)-benzenesulfinate is sourced from PubChem (CID 11735002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).