2-methoxysulfinylbenzoic acid

C8H8O4S — CID 19855526

IUPAC2-methoxysulfinylbenzoic acid
SMILESCOS(=O)c1ccccc1C(=O)O
InChIInChI=1S/C8H8O4S/c1-12-13(11)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)
InChIKeyYIGUZUAMIUWECJ-UHFFFAOYSA-N
MW200.22 g/mol
LogP1.05
Rot. Bonds3

About 2-methoxysulfinylbenzoic acid

2-methoxysulfinylbenzoic acid (PubChem CID 19855526) has the molecular formula C8H8O4S and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-methoxysulfinylbenzoic acid.

Molecular Properties

Compound Name2-methoxysulfinylbenzoic acid
PubChem CID19855526
Molecular FormulaC8H8O4S
Molecular Weight200.22 g/mol
Exact Mass200.01
IUPAC Name2-methoxysulfinylbenzoic acid
SMILESCOS(=O)c1ccccc1C(=O)O
InChIInChI=1S/C8H8O4S/c1-12-13(11)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10)
InChIKeyYIGUZUAMIUWECJ-UHFFFAOYSA-N
XLogP1.05
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.22
LogP ≤ 51.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methoxysulfinylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methoxysulfinylbenzoic acid?
The IUPAC name of 2-methoxysulfinylbenzoic acid (CID 19855526) is 2-methoxysulfinylbenzoic acid.
What is the SMILES notation for 2-methoxysulfinylbenzoic acid?
The canonical SMILES for 2-methoxysulfinylbenzoic acid is COS(=O)c1ccccc1C(=O)O.
What is the InChIKey of 2-methoxysulfinylbenzoic acid?
The InChIKey is YIGUZUAMIUWECJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4S/c1-12-13(11)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10).
What are the key properties of 2-methoxysulfinylbenzoic acid?
2-methoxysulfinylbenzoic acid has a molecular weight of 200.22 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxysulfinylbenzoic acid is sourced from PubChem (CID 19855526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).