About 2-methoxysulfinylbenzoic acid
2-methoxysulfinylbenzoic acid (PubChem CID 19855526) has the molecular formula C8H8O4S
and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-methoxysulfinylbenzoic acid.
Molecular Properties
| Compound Name | 2-methoxysulfinylbenzoic acid |
| PubChem CID | 19855526 |
| Molecular Formula | C8H8O4S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 2-methoxysulfinylbenzoic acid |
| SMILES | COS(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C8H8O4S/c1-12-13(11)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10) |
| InChIKey | YIGUZUAMIUWECJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxysulfinylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxysulfinylbenzoic acid?
The IUPAC name of 2-methoxysulfinylbenzoic acid (CID 19855526) is 2-methoxysulfinylbenzoic acid.
What is the SMILES notation for 2-methoxysulfinylbenzoic acid?
The canonical SMILES for 2-methoxysulfinylbenzoic acid is COS(=O)c1ccccc1C(=O)O.
What is the InChIKey of 2-methoxysulfinylbenzoic acid?
The InChIKey is YIGUZUAMIUWECJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4S/c1-12-13(11)7-5-3-2-4-6(7)8(9)10/h2-5H,1H3,(H,9,10).
What are the key properties of 2-methoxysulfinylbenzoic acid?
2-methoxysulfinylbenzoic acid has a molecular weight of 200.22 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxysulfinylbenzoic acid is sourced from PubChem (CID 19855526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).