About benzyl benzenesulfinate
benzyl benzenesulfinate (PubChem CID 14197759) has the molecular formula C13H12O2S
and a molecular weight of 232.30 g/mol. Its IUPAC name is benzyl benzenesulfinate.
Molecular Properties
| Compound Name | benzyl benzenesulfinate |
| PubChem CID | 14197759 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | benzyl benzenesulfinate |
| SMILES | O=S(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12O2S/c14-16(13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2 |
| InChIKey | GTSQMEFZVYAYQK-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl benzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl benzenesulfinate?
The IUPAC name of benzyl benzenesulfinate (CID 14197759) is benzyl benzenesulfinate.
What is the SMILES notation for benzyl benzenesulfinate?
The canonical SMILES for benzyl benzenesulfinate is O=S(OCc1ccccc1)c1ccccc1.
What is the InChIKey of benzyl benzenesulfinate?
The InChIKey is GTSQMEFZVYAYQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2S/c14-16(13-9-5-2-6-10-13)15-11-12-7-3-1-4-8-12/h1-10H,11H2.
What are the key properties of benzyl benzenesulfinate?
benzyl benzenesulfinate has a molecular weight of 232.30 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl benzenesulfinate is sourced from PubChem (CID 14197759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).