About (4-phenylphenyl)methyl sulfite
(4-phenylphenyl)methyl sulfite (PubChem CID 175522755) has the molecular formula C13H11O3S-
and a molecular weight of 247.30 g/mol. Its IUPAC name is (4-phenylphenyl)methyl sulfite.
Molecular Properties
| Compound Name | (4-phenylphenyl)methyl sulfite |
| PubChem CID | 175522755 |
| Molecular Formula | C13H11O3S- |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | (4-phenylphenyl)methyl sulfite |
| SMILES | O=S([O-])OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O3S/c14-17(15)16-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,14,15)/p-1 |
| InChIKey | NOLLPTVJZANMAW-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylphenyl)methyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl)methyl sulfite?
The IUPAC name of (4-phenylphenyl)methyl sulfite (CID 175522755) is (4-phenylphenyl)methyl sulfite.
What is the SMILES notation for (4-phenylphenyl)methyl sulfite?
The canonical SMILES for (4-phenylphenyl)methyl sulfite is O=S([O-])OCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of (4-phenylphenyl)methyl sulfite?
The InChIKey is NOLLPTVJZANMAW-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H12O3S/c14-17(15)16-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,14,15)/p-1.
What are the key properties of (4-phenylphenyl)methyl sulfite?
(4-phenylphenyl)methyl sulfite has a molecular weight of 247.30 g/mol, XLogP of 2.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl)methyl sulfite is sourced from PubChem (CID 175522755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).