About 1-pyridin-3-ylethyl sulfite
1-pyridin-3-ylethyl sulfite (PubChem CID 174501861) has the molecular formula C7H8NO3S-
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-pyridin-3-ylethyl sulfite.
Molecular Properties
| Compound Name | 1-pyridin-3-ylethyl sulfite |
| PubChem CID | 174501861 |
| Molecular Formula | C7H8NO3S- |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 1-pyridin-3-ylethyl sulfite |
| SMILES | CC(OS(=O)[O-])c1cccnc1 |
| InChI | InChI=1S/C7H9NO3S/c1-6(11-12(9)10)7-3-2-4-8-5-7/h2-6H,1H3,(H,9,10)/p-1 |
| InChIKey | FJGHKILVDVLGRS-UHFFFAOYSA-M |
| XLogP | 0.95 |
| TPSA | 62.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-3-ylethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-3-ylethyl sulfite?
The IUPAC name of 1-pyridin-3-ylethyl sulfite (CID 174501861) is 1-pyridin-3-ylethyl sulfite.
What is the SMILES notation for 1-pyridin-3-ylethyl sulfite?
The canonical SMILES for 1-pyridin-3-ylethyl sulfite is CC(OS(=O)[O-])c1cccnc1.
What is the InChIKey of 1-pyridin-3-ylethyl sulfite?
The InChIKey is FJGHKILVDVLGRS-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9NO3S/c1-6(11-12(9)10)7-3-2-4-8-5-7/h2-6H,1H3,(H,9,10)/p-1.
What are the key properties of 1-pyridin-3-ylethyl sulfite?
1-pyridin-3-ylethyl sulfite has a molecular weight of 186.21 g/mol, XLogP of 0.95, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-3-ylethyl sulfite is sourced from PubChem (CID 174501861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).