C13H11NO2S — CID 14484919
6-pyridin-3-ylsulfanyl-2,3-dihydro-1-benzofuran-5-ol (PubChem CID 14484919) has the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. Its IUPAC name is 6-pyridin-3-ylsulfanyl-2,3-dihydro-1-benzofuran-5-ol.
| Compound Name | 6-pyridin-3-ylsulfanyl-2,3-dihydro-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 14484919 |
| Molecular Formula | C13H11NO2S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 6-pyridin-3-ylsulfanyl-2,3-dihydro-1-benzofuran-5-ol |
| SMILES | Oc1cc2c(cc1Sc1cccnc1)OCC2 |
| InChI | InChI=1S/C13H11NO2S/c15-11-6-9-3-5-16-12(9)7-13(11)17-10-2-1-4-14-8-10/h1-2,4,6-8,15H,3,5H2 |
| InChIKey | LCSGDSTWIVCWAQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |