C9H10N2O3 — CID 153262456
N',6-dihydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide (PubChem CID 153262456) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is N',6-dihydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide.
| Compound Name | N',6-dihydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 153262456 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | N',6-dihydroxy-2,3-dihydro-1-benzofuran-5-carboximidamide |
| SMILES | NC(=NO)c1cc2c(cc1O)OCC2 |
| InChI | InChI=1S/C9H10N2O3/c10-9(11-13)6-3-5-1-2-14-8(5)4-7(6)12/h3-4,12-13H,1-2H2,(H2,10,11) |
| InChIKey | WVMZBWDLJDHDJI-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|