C11H14N2O2 — CID 83882758
2-(3,4-dihydro-2H-chromen-6-yl)-N'-hydroxyethanimidamide (PubChem CID 83882758) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-chromen-6-yl)-N'-hydroxyethanimidamide.
| Compound Name | 2-(3,4-dihydro-2H-chromen-6-yl)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 83882758 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 2-(3,4-dihydro-2H-chromen-6-yl)-N'-hydroxyethanimidamide |
| SMILES | N/C(Cc1ccc2c(c1)CCCO2)=N\O |
| InChI | InChI=1S/C11H14N2O2/c12-11(13-14)7-8-3-4-10-9(6-8)2-1-5-15-10/h3-4,6,14H,1-2,5,7H2,(H2,12,13) |
| InChIKey | CUXGDQTYIXPUSB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|