C13H16N2O3 — CID 115191993
N'-(3,4-dihydro-2H-chromen-6-ylmethyl)-N'-methyloxamide (PubChem CID 115191993) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is N'-(3,4-dihydro-2H-chromen-6-ylmethyl)-N'-methyloxamide.
| Compound Name | N'-(3,4-dihydro-2H-chromen-6-ylmethyl)-N'-methyloxamide |
|---|---|
| PubChem CID | 115191993 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N'-(3,4-dihydro-2H-chromen-6-ylmethyl)-N'-methyloxamide |
| SMILES | CN(Cc1ccc2c(c1)CCCO2)C(=O)C(N)=O |
| InChI | InChI=1S/C13H16N2O3/c1-15(13(17)12(14)16)8-9-4-5-11-10(7-9)3-2-6-18-11/h4-5,7H,2-3,6,8H2,1H3,(H2,14,16) |
| InChIKey | HHDAEEIEBFMUKO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|