N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride

C9H8ClNO2 — CID 112756407

IUPACN-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride
SMILESON=C(Cl)c1ccc2c(c1)CCO2
InChIInChI=1S/C9H8ClNO2/c10-9(11-12)7-1-2-8-6(5-7)3-4-13-8/h1-2,5,12H,3-4H2
InChIKeyYFKNLMTWFZGCEK-UHFFFAOYSA-N
MW197.62 g/mol
LogP2.00
Rot. Bonds1

About N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride

N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride (PubChem CID 112756407) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride.

Molecular Properties

Compound NameN-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride
PubChem CID112756407
Molecular FormulaC9H8ClNO2
Molecular Weight197.62 g/mol
Exact Mass197.02
IUPAC NameN-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride
SMILESON=C(Cl)c1ccc2c(c1)CCO2
InChIInChI=1S/C9H8ClNO2/c10-9(11-12)7-1-2-8-6(5-7)3-4-13-8/h1-2,5,12H,3-4H2
InChIKeyYFKNLMTWFZGCEK-UHFFFAOYSA-N
XLogP2.00
TPSA41.82 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.62
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride?
The IUPAC name of N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride (CID 112756407) is N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride.
What is the SMILES notation for N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride?
The canonical SMILES for N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride is ON=C(Cl)c1ccc2c(c1)CCO2.
What is the InChIKey of N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride?
The InChIKey is YFKNLMTWFZGCEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO2/c10-9(11-12)7-1-2-8-6(5-7)3-4-13-8/h1-2,5,12H,3-4H2.
What are the key properties of N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride?
N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride has a molecular weight of 197.62 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride is sourced from PubChem (CID 112756407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).