C9H8ClNO2 — CID 112756407
N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride (PubChem CID 112756407) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride.
| Compound Name | N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride |
|---|---|
| PubChem CID | 112756407 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | N-hydroxy-2,3-dihydro-1-benzofuran-5-carboximidoyl chloride |
| SMILES | ON=C(Cl)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H8ClNO2/c10-9(11-12)7-1-2-8-6(5-7)3-4-13-8/h1-2,5,12H,3-4H2 |
| InChIKey | YFKNLMTWFZGCEK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|