C9H10O3 — CID 10953886
5-methoxy-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 10953886) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-methoxy-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 5-methoxy-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 10953886 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 5-methoxy-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | COc1cc2c(cc1O)OCC2 |
| InChI | InChI=1S/C9H10O3/c1-11-9-4-6-2-3-12-8(6)5-7(9)10/h4-5,10H,2-3H2,1H3 |
| InChIKey | SRZDJTYUSFPWBG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |