About 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol
2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol (PubChem CID 162092836) has the molecular formula C16H18O4
and a molecular weight of 274.32 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol.
Molecular Properties
| Compound Name | 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol |
| PubChem CID | 162092836 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol |
| SMILES | COc1cc(O)ccc1C.Oc1ccc2c(c1)OCC2 |
| InChI | InChI=1S/C8H8O2.C8H10O2/c9-7-2-1-6-3-4-10-8(6)5-7;1-6-3-4-7(9)5-8(6)10-2/h1-2,5,9H,3-4H2;3-5,9H,1-2H3 |
| InChIKey | ZDVRYZDSAZYTBC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol?
The IUPAC name of 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol (CID 162092836) is 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol.
What is the SMILES notation for 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol?
The canonical SMILES for 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol is COc1cc(O)ccc1C.Oc1ccc2c(c1)OCC2.
What is the InChIKey of 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol?
The InChIKey is ZDVRYZDSAZYTBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2.C8H10O2/c9-7-2-1-6-3-4-10-8(6)5-7;1-6-3-4-7(9)5-8(6)10-2/h1-2,5,9H,3-4H2;3-5,9H,1-2H3.
What are the key properties of 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol?
2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol has a molecular weight of 274.32 g/mol, XLogP of 3.04, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1-benzofuran-6-ol;3-methoxy-4-methylphenol is sourced from PubChem (CID 162092836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).