C8H11FO — CID 163210270
3,4-dimethylphenol;hydrofluoride (PubChem CID 163210270) has the molecular formula C8H11FO and a molecular weight of 142.17 g/mol. Its IUPAC name is 3,4-dimethylphenol;hydrofluoride.
| Compound Name | 3,4-dimethylphenol;hydrofluoride |
|---|---|
| PubChem CID | 163210270 |
| Molecular Formula | C8H11FO |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 3,4-dimethylphenol;hydrofluoride |
| SMILES | Cc1ccc(O)cc1C.F |
| InChI | InChI=1S/C8H10O.FH/c1-6-3-4-8(9)5-7(6)2;/h3-5,9H,1-2H3;1H |
| InChIKey | CNWZGBJFHZROFF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |