C12H17BrO5 — CID 22159432
6-bromo-2,3-dihydro-1-benzofuran-5-ol;methoxy(methoxymethoxy)methane (PubChem CID 22159432) has the molecular formula C12H17BrO5 and a molecular weight of 321.17 g/mol. Its IUPAC name is 6-bromo-2,3-dihydro-1-benzofuran-5-ol;methoxy(methoxymethoxy)methane.
| Compound Name | 6-bromo-2,3-dihydro-1-benzofuran-5-ol;methoxy(methoxymethoxy)methane |
|---|---|
| PubChem CID | 22159432 |
| Molecular Formula | C12H17BrO5 |
| Molecular Weight | 321.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 6-bromo-2,3-dihydro-1-benzofuran-5-ol;methoxy(methoxymethoxy)methane |
| SMILES | COCOCOC.Oc1cc2c(cc1Br)OCC2 |
| InChI | InChI=1S/C8H7BrO2.C4H10O3/c9-6-4-8-5(1-2-11-8)3-7(6)10;1-5-3-7-4-6-2/h3-4,10H,1-2H2;3-4H2,1-2H3 |
| InChIKey | RZVTUHDMUUPASO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|