C12H14O4 — CID 24977225
1-[6-(methoxymethoxy)-2,3-dihydro-1-benzofuran-5-yl]ethanone (PubChem CID 24977225) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-[6-(methoxymethoxy)-2,3-dihydro-1-benzofuran-5-yl]ethanone.
| Compound Name | 1-[6-(methoxymethoxy)-2,3-dihydro-1-benzofuran-5-yl]ethanone |
|---|---|
| PubChem CID | 24977225 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-[6-(methoxymethoxy)-2,3-dihydro-1-benzofuran-5-yl]ethanone |
| SMILES | COCOc1cc2c(cc1C(C)=O)CCO2 |
| InChI | InChI=1S/C12H14O4/c1-8(13)10-5-9-3-4-15-11(9)6-12(10)16-7-14-2/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | NLLQNISJQFVIBF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|