C14H20O7 — CID 10935461
1-[2,4,6-tris(methoxymethoxy)phenyl]ethanone (PubChem CID 10935461) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is 1-[2,4,6-tris(methoxymethoxy)phenyl]ethanone.
| Compound Name | 1-[2,4,6-tris(methoxymethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 10935461 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 1-[2,4,6-tris(methoxymethoxy)phenyl]ethanone |
| SMILES | COCOc1cc(OCOC)c(C(C)=O)c(OCOC)c1 |
| InChI | InChI=1S/C14H20O7/c1-10(15)14-12(20-8-17-3)5-11(19-7-16-2)6-13(14)21-9-18-4/h5-6H,7-9H2,1-4H3 |
| InChIKey | VRDSPVUFCCVMCF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|