C12H16O4 — CID 819891
1-(2,4-diethoxy-6-hydroxyphenyl)ethanone (PubChem CID 819891) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(2,4-diethoxy-6-hydroxyphenyl)ethanone.
| Compound Name | 1-(2,4-diethoxy-6-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 819891 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-(2,4-diethoxy-6-hydroxyphenyl)ethanone |
| SMILES | CCOc1cc(O)c(C(C)=O)c(OCC)c1 |
| InChI | InChI=1S/C12H16O4/c1-4-15-9-6-10(14)12(8(3)13)11(7-9)16-5-2/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | ZQSXHBMSOWNCNP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |