C16H24O5 — CID 93191508
3-methoxy-1-(2,4,6-triethoxyphenyl)propan-1-one (PubChem CID 93191508) has the molecular formula C16H24O5 and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-methoxy-1-(2,4,6-triethoxyphenyl)propan-1-one.
| Compound Name | 3-methoxy-1-(2,4,6-triethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 93191508 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-methoxy-1-(2,4,6-triethoxyphenyl)propan-1-one |
| SMILES | CCOc1cc(OCC)c(C(=O)CCOC)c(OCC)c1 |
| InChI | InChI=1S/C16H24O5/c1-5-19-12-10-14(20-6-2)16(13(17)8-9-18-4)15(11-12)21-7-3/h10-11H,5-9H2,1-4H3 |
| InChIKey | BOJJGWKWMGGHJO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |