C38H54O11S — CID 161016297
tris(2,4,6-triethoxyphenyl)sulfanium acetate (PubChem CID 161016297) has the molecular formula C38H54O11S and a molecular weight of 718.91 g/mol. Its IUPAC name is tris(2,4,6-triethoxyphenyl)sulfanium acetate.
| Compound Name | tris(2,4,6-triethoxyphenyl)sulfanium acetate |
|---|---|
| PubChem CID | 161016297 |
| Molecular Formula | C38H54O11S |
| Molecular Weight | 718.91 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | tris(2,4,6-triethoxyphenyl)sulfanium acetate |
| SMILES | CC(=O)[O-].CCOc1cc(OCC)c([S+](c2c(OCC)cc(OCC)cc2OCC)c2c(OCC)cc(OCC)cc2OCC)c(OCC)c1 |
| InChI | InChI=1S/C36H51O9S.C2H4O2/c1-10-37-25-19-28(40-13-4)34(29(20-25)41-14-5)46(35-30(42-15-6)21-26(38-11-2)22-31(35)43-16-7)36-32(44-17-8)23-27(39-12-3)24-33(36)45-18-9;1-2(3)4/h19-24H,10-18H2,1-9H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | OUVUVZSHEXNHFG-UHFFFAOYSA-M |
| XLogP | 7.13 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.91 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|