C54H87O9S+ — CID 157331235
tris(2,4,6-tributoxyphenyl)sulfanium (PubChem CID 157331235) has the molecular formula C54H87O9S+ and a molecular weight of 912.35 g/mol. Its IUPAC name is tris(2,4,6-tributoxyphenyl)sulfanium.
| Compound Name | tris(2,4,6-tributoxyphenyl)sulfanium |
|---|---|
| PubChem CID | 157331235 |
| Molecular Formula | C54H87O9S+ |
| Molecular Weight | 912.35 g/mol |
| Exact Mass | 911.61 |
| IUPAC Name | tris(2,4,6-tributoxyphenyl)sulfanium |
| SMILES | CCCCOc1cc(OCCCC)c([S+](c2c(OCCCC)cc(OCCCC)cc2OCCCC)c2c(OCCCC)cc(OCCCC)cc2OCCCC)c(OCCCC)c1 |
| InChI | InChI=1S/C54H87O9S/c1-10-19-28-55-43-37-46(58-31-22-13-4)52(47(38-43)59-32-23-14-5)64(53-48(60-33-24-15-6)39-44(56-29-20-11-2)40-49(53)61-34-25-16-7)54-50(62-35-26-17-8)41-45(57-30-21-12-3)42-51(54)63-36-27-18-9/h37-42H,10-36H2,1-9H3/q+1 |
| InChIKey | IDGPUMOACWOXNV-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.35 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|