C20H34O2 — CID 23531654
1,5-dihexoxy-2,3-dimethylbenzene (PubChem CID 23531654) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1,5-dihexoxy-2,3-dimethylbenzene.
| Compound Name | 1,5-dihexoxy-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 23531654 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1,5-dihexoxy-2,3-dimethylbenzene |
| SMILES | CCCCCCOc1cc(C)c(C)c(OCCCCCC)c1 |
| InChI | InChI=1S/C20H34O2/c1-5-7-9-11-13-21-19-15-17(3)18(4)20(16-19)22-14-12-10-8-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | RPEQICXHNFZCST-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|