C29H42O — CID 162161210
5-decoxy-1,2,3-trimethylbenzene;1-methyl-4-prop-1-ynylbenzene (PubChem CID 162161210) has the molecular formula C29H42O and a molecular weight of 406.65 g/mol. Its IUPAC name is 5-decoxy-1,2,3-trimethylbenzene;1-methyl-4-prop-1-ynylbenzene.
| Compound Name | 5-decoxy-1,2,3-trimethylbenzene;1-methyl-4-prop-1-ynylbenzene |
|---|---|
| PubChem CID | 162161210 |
| Molecular Formula | C29H42O |
| Molecular Weight | 406.65 g/mol |
| Exact Mass | 406.32 |
| IUPAC Name | 5-decoxy-1,2,3-trimethylbenzene;1-methyl-4-prop-1-ynylbenzene |
| SMILES | CC#Cc1ccc(C)cc1.CCCCCCCCCCOc1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C19H32O.C10H10/c1-5-6-7-8-9-10-11-12-13-20-19-14-16(2)18(4)17(3)15-19;1-3-4-10-7-5-9(2)6-8-10/h14-15H,5-13H2,1-4H3;5-8H,1-2H3 |
| InChIKey | ZMMWHBAYIVTKAE-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.65 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|