C14H23N2O2+ — CID 59821708
(2,4-dibutoxyphenyl)iminoazanium (PubChem CID 59821708) has the molecular formula C14H23N2O2+ and a molecular weight of 251.35 g/mol. Its IUPAC name is (2,4-dibutoxyphenyl)iminoazanium.
| Compound Name | (2,4-dibutoxyphenyl)iminoazanium |
|---|---|
| PubChem CID | 59821708 |
| Molecular Formula | C14H23N2O2+ |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.18 |
| IUPAC Name | (2,4-dibutoxyphenyl)iminoazanium |
| SMILES | CCCCOc1ccc(N=[NH2+])c(OCCCC)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-3-5-9-17-12-7-8-13(16-15)14(11-12)18-10-6-4-2/h7-8,11,15H,3-6,9-10H2,1-2H3/p+1 |
| InChIKey | YMNUTOOHSOVQDD-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|