C12H12N2O3 — CID 139627431
2-butoxy-1,4-diisocyanatobenzene (PubChem CID 139627431) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-butoxy-1,4-diisocyanatobenzene.
| Compound Name | 2-butoxy-1,4-diisocyanatobenzene |
|---|---|
| PubChem CID | 139627431 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-butoxy-1,4-diisocyanatobenzene |
| SMILES | CCCCOc1cc(N=C=O)ccc1N=C=O |
| InChI | InChI=1S/C12H12N2O3/c1-2-3-6-17-12-7-10(13-8-15)4-5-11(12)14-9-16/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | UHNCULIWJXKMRY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|