C24H29NO4 — CID 102253109
5-[(E)-2-(4-isocyanatophenyl)ethenyl]-1,2,3-tripropoxybenzene (PubChem CID 102253109) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is 5-[(E)-2-(4-isocyanatophenyl)ethenyl]-1,2,3-tripropoxybenzene.
| Compound Name | 5-[(E)-2-(4-isocyanatophenyl)ethenyl]-1,2,3-tripropoxybenzene |
|---|---|
| PubChem CID | 102253109 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 5-[(E)-2-(4-isocyanatophenyl)ethenyl]-1,2,3-tripropoxybenzene |
| SMILES | CCCOc1cc(/C=C/c2ccc(N=C=O)cc2)cc(OCCC)c1OCCC |
| InChI | InChI=1S/C24H29NO4/c1-4-13-27-22-16-20(8-7-19-9-11-21(12-10-19)25-18-26)17-23(28-14-5-2)24(22)29-15-6-3/h7-12,16-17H,4-6,13-15H2,1-3H3/b8-7+ |
| InChIKey | XOVZMTRHTQKRSZ-BQYQJAHWSA-N |
| XLogP | 6.19 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|