C33H53N2O2+ — CID 20729269
[2,5-didecoxy-4-(4-methylphenyl)phenyl]iminoazanium (PubChem CID 20729269) has the molecular formula C33H53N2O2+ and a molecular weight of 509.80 g/mol. Its IUPAC name is [2,5-didecoxy-4-(4-methylphenyl)phenyl]iminoazanium.
| Compound Name | [2,5-didecoxy-4-(4-methylphenyl)phenyl]iminoazanium |
|---|---|
| PubChem CID | 20729269 |
| Molecular Formula | C33H53N2O2+ |
| Molecular Weight | 509.80 g/mol |
| Exact Mass | 509.41 |
| IUPAC Name | [2,5-didecoxy-4-(4-methylphenyl)phenyl]iminoazanium |
| SMILES | CCCCCCCCCCOc1cc(-c2ccc(C)cc2)c(OCCCCCCCCCC)cc1N=[NH2+] |
| InChI | InChI=1S/C33H52N2O2/c1-4-6-8-10-12-14-16-18-24-36-32-27-31(35-34)33(26-30(32)29-22-20-28(3)21-23-29)37-25-19-17-15-13-11-9-7-5-2/h20-23,26-27,34H,4-19,24-25H2,1-3H3/p+1 |
| InChIKey | MEWLRWSKPSHOMV-UHFFFAOYSA-O |
| XLogP | 9.54 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.80 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|