C28H43N2O4+ — CID 20729291
[3,6-diheptoxy-2-methoxy-4-(4-methoxyphenyl)phenyl]iminoazanium (PubChem CID 20729291) has the molecular formula C28H43N2O4+ and a molecular weight of 471.66 g/mol. Its IUPAC name is [3,6-diheptoxy-2-methoxy-4-(4-methoxyphenyl)phenyl]iminoazanium.
| Compound Name | [3,6-diheptoxy-2-methoxy-4-(4-methoxyphenyl)phenyl]iminoazanium |
|---|---|
| PubChem CID | 20729291 |
| Molecular Formula | C28H43N2O4+ |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.32 |
| IUPAC Name | [3,6-diheptoxy-2-methoxy-4-(4-methoxyphenyl)phenyl]iminoazanium |
| SMILES | CCCCCCCOc1cc(-c2ccc(OC)cc2)c(OCCCCCCC)c(OC)c1N=[NH2+] |
| InChI | InChI=1S/C28H42N2O4/c1-5-7-9-11-13-19-33-25-21-24(22-15-17-23(31-3)18-16-22)27(28(32-4)26(25)30-29)34-20-14-12-10-8-6-2/h15-18,21,29H,5-14,19-20H2,1-4H3/p+1 |
| InChIKey | DPTLDPGVUKECKG-UHFFFAOYSA-O |
| XLogP | 6.91 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|